Andre Roget
6Patents
3h-index
7Co-inventors
46Inventor score
Filing activity: Oct 7, 1988 → Nov 20, 2003
Most-cited inventions
| Patent | Title | Area | Cited by | Status |
|---|---|---|---|---|
| US5837859A | Preparation of a electronically conductive polymer/nucleotide copolymer | Performing Operations; Transporting | 64 | Expired |
| US6197949A | Electronically conductive polymer/nucleotide copolymer. preparation method therefor and use thereof | Performing Operations; Transporting | 8 | Expired |
| US5179200A | N4-(3-phenylproprionyl)-2'-deoxycytidine | Chemistry; Metallurgy | 4 | Expired |
| US6187914A | Nucleoside derivatives, and their use in oligonucleotide synthesis | Chemistry; Metallurgy | 2 | Expired |
| US6207797A | Method for reducing the surface reactivity of copolymers produced by electrochemical polymerization | Chemistry; Metallurgy | 1 | Expired |
| US7998726B2 | Method for fixing a protein on a pyrrole-based polymer and use thereof for making a sensor | Physics | 0 | Expired |
Source: USPTO / EPO open patent data. Inventor disambiguation is heuristic; counts are objective bibliographic measures.