Hansjorg Eibl
28Patents
11h-index
15Co-inventors
72Inventor score
Filing activity: Aug 28, 1974 → Jun 18, 2014
Most-cited inventions
| Patent | Title | Area | Cited by | Status |
|---|---|---|---|---|
| US4159988A | Synthetic phospholipids, a process for their manufacture and their use | Human Necessities | 50 | Expired |
| US6649780B1 | Cationic lipids | Chemistry; Metallurgy | 38 | Expired |
| US5153179A | Medicament with improved penetration of the tissue membrane | Chemistry; Metallurgy | 33 | Expired |
| US4837023A | Compositions containing hexadecylophosphocholine and alkylglycerols and uses thereof | Chemistry; Metallurgy | 33 | Expired |
| US4971802A | Liposomes of synthetic lipids | Emerging Cross-Sectional Technologies | 19 | Expired |
| US4382035A | Glycerol-3-phosphoric acid halogenoalkyl esters and processes for their preparation and further conversion | Chemistry; Metallurgy | 16 | Expired |
| US5049552A | Compositions containing hexadecylphosphocholine and use thereof | Chemistry; Metallurgy | 16 | Expired |
| US5436234A | Eurcyl, brassidyl and nervonyl derivatives | Chemistry; Metallurgy | 14 | Expired |
| US4163748A | Propane-1,3-diol phosphatides and method of preparing the same | Emerging Cross-Sectional Technologies | 12 | Expired |
| US5626867A | Liposomes with a negative excess charge | Emerging Cross-Sectional Technologies | 12 | Expired |
| US4734225A | D-mannite derivatives as starting products for the synthesis of phospholipids | Chemistry; Metallurgy | 11 | Expired |
| US4804789A | D-mannite derivatives as starting products for the synthesis of phospholipids | Chemistry; Metallurgy | 10 | Expired |
| US4316730A | Filter for the removal of apolar organic substances from gases | Performing Operations; Transporting | 9 | Expired |
| US3960905A | Diacylglycerophosphoric acid esters of aminoethanol and methylaminoethanol and method of preparing the same | Chemistry; Metallurgy | 5 | Expired |
| US5980915A | Process for the production of a pharmaceutical agent for oral or topical administration in the treatment of leishmaniasis | Emerging Cross-Sectional Technologies | 5 | Expired |
| US3940423A | 1,2-O-dialkylmethylidene-glycero-3-phosphatides | Chemistry; Metallurgy | 4 | Expired |
| US4749805A | Phospholipid-like compounds | Chemistry; Metallurgy | 4 | Expired |
| US5290769A | Use of hexadecylphosphocholine for the treatment of psoriasis | Human Necessities | 3 | Expired |
| US4160773A | Synthetic alkyl esters of phospholipid acid, structural analogs thereof and a process for their manufacture and their use | Emerging Cross-Sectional Technologies | 3 | Expired |
| US5916884A | Compositions containing a mixture of phosphorus compounds and alkylglycerols | Human Necessities | 3 | Expired |
| US4739095A | Derivatives of N,N-(2-chloro-ethyl)-phosphoric acid amide | Chemistry; Metallurgy | 2 | Expired |
| US6254879A | Methods of treating protozoal diseases | Emerging Cross-Sectional Technologies | 1 | Expired |
| US8828972B2 | Formulations containing alkylphosphocholines using novel negative charge carriers | Emerging Cross-Sectional Technologies | 1 | Active |
| US8273727B2 | Lipid-analogous phosphoric triesters | Chemistry; Metallurgy | 0 | Active |
| US6506393B2 | Methods of treating protozoal diseases | Emerging Cross-Sectional Technologies | 0 | Expired |
Source: USPTO / EPO open patent data. Inventor disambiguation is heuristic; counts are objective bibliographic measures.