Robert Teoule
12Patents
7h-index
13Co-inventors
59Inventor score
Filing activity: Mar 30, 1987 → Dec 3, 1999
Most-cited inventions
| Patent | Title | Area | Cited by | Status |
|---|---|---|---|---|
| US5795715A | Process for preparing double-stranded RNA, and its applications | Chemistry; Metallurgy | 88 | Expired |
| US5837859A | Preparation of a electronically conductive polymer/nucleotide copolymer | Performing Operations; Transporting | 64 | Expired |
| US4980460A | Protected nucleosides which permit more efficient oligonucleotide syntheses | Chemistry; Metallurgy | 43 | Expired |
| US5552539A | Process for the synthesis of ribonucleic acid (RNA) using a novel deprotection reagent | Emerging Cross-Sectional Technologies | 18 | Expired |
| US5514540A | Method for detecting specific nucleic acid sequences by amplification in highly dilute solution | Chemistry; Metallurgy | 11 | Expired |
| US6197949A | Electronically conductive polymer/nucleotide copolymer. preparation method therefor and use thereof | Performing Operations; Transporting | 8 | Expired |
| US5776791A | Process for collective manufacture of chips with electrodes selectively covered by a deposit | Chemistry; Metallurgy | 7 | Expired |
| US5204456A | Derivatives of nucleosides and their use for the synthesis of oligonucleotides | Chemistry; Metallurgy | 5 | Expired |
| US5179200A | N4-(3-phenylproprionyl)-2'-deoxycytidine | Chemistry; Metallurgy | 4 | Expired |
| US6187914A | Nucleoside derivatives, and their use in oligonucleotide synthesis | Chemistry; Metallurgy | 2 | Expired |
| US6207797A | Method for reducing the surface reactivity of copolymers produced by electrochemical polymerization | Chemistry; Metallurgy | 1 | Expired |
| US6210932A | System for detecting nucleic acid hybridization, preparation method and application thereof | Emerging Cross-Sectional Technologies | 1 | Expired |
Source: USPTO / EPO open patent data. Inventor disambiguation is heuristic; counts are objective bibliographic measures.